C24H23N3O4S2 — CID 3814436
5-[(3-methoxyphenyl)methylidene]-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3814436) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)methylidene]-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-methoxyphenyl)methylidene]-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3814436 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 5-[(3-methoxyphenyl)methylidene]-3-[2-oxo-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(C=C2SC(=S)N(CC(=O)N3CC4CC(C3)c3cccc(=O)n3C4)C2=O)c1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-31-18-5-2-4-15(9-18)10-20-23(30)27(24(32)33-20)14-22(29)25-11-16-8-17(13-25)19-6-3-7-21(28)26(19)12-16/h2-7,9-10,16-17H,8,11-14H2,1H3 |
| InChIKey | XGKAKVSVYODRTF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|