C20H21BrN2O4 — CID 171140772
4-(4-bromophenoxy)-N-(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)butanamide (PubChem CID 171140772) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)butanamide.
| Compound Name | 4-(4-bromophenoxy)-N-(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)butanamide |
|---|---|
| PubChem CID | 171140772 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-(4-bromophenoxy)-N-(2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)butanamide |
| SMILES | CC1(C)Oc2cc(NC(=O)CCCOc3ccc(Br)cc3)ccc2NC1=O |
| InChI | InChI=1S/C20H21BrN2O4/c1-20(2)19(25)23-16-10-7-14(12-17(16)27-20)22-18(24)4-3-11-26-15-8-5-13(21)6-9-15/h5-10,12H,3-4,11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | RQOGGWWTKJKDQK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|