C16H27N3O2 — CID 171147164
(5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 171147164) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 171147164 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (5aS,9aR)-7-[4-(dimethylamino)but-2-enoyl]-1-methyl-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | CN(C)CC=CC(=O)N1CC[C@@H]2[C@@H](CCCC(=O)N2C)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-17(2)10-5-8-16(21)19-11-9-14-13(12-19)6-4-7-15(20)18(14)3/h5,8,13-14H,4,6-7,9-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | CERTYZUOLOJIGJ-UONOGXRCSA-N |
| XLogP | 0.96 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|