C20H26N2O2 — CID 171147214
2-[(3S,4S)-3-hydroxy-4-[(3-methylphenyl)methyl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 171147214) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(3S,4S)-3-hydroxy-4-[(3-methylphenyl)methyl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | 2-[(3S,4S)-3-hydroxy-4-[(3-methylphenyl)methyl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 171147214 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[(3S,4S)-3-hydroxy-4-[(3-methylphenyl)methyl]piperidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | Cc1cccc(C[C@H]2CCN(C(=O)C(C#N)=CC(C)C)C[C@H]2O)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-14(2)9-18(12-21)20(24)22-8-7-17(19(23)13-22)11-16-6-4-5-15(3)10-16/h4-6,9-10,14,17,19,23H,7-8,11,13H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | HADINICATYFCNE-IEBWSBKVSA-N |
| XLogP | 2.85 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|