C22H33N5O4 — CID 171148610
2-[7-(2-methoxyethyl)-5-(2-methylpropyl)-3,6-dioxo-1,5,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-pyridin-3-ylethyl)acetamide (PubChem CID 171148610) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[7-(2-methoxyethyl)-5-(2-methylpropyl)-3,6-dioxo-1,5,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-pyridin-3-ylethyl)acetamide.
| Compound Name | 2-[7-(2-methoxyethyl)-5-(2-methylpropyl)-3,6-dioxo-1,5,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-pyridin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 171148610 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2-[7-(2-methoxyethyl)-5-(2-methylpropyl)-3,6-dioxo-1,5,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl]-N-(2-pyridin-3-ylethyl)acetamide |
| SMILES | COCCN1CC2CN(CC(=O)NCCc3cccnc3)C(=O)N2C(CC(C)C)C1=O |
| InChI | InChI=1S/C22H33N5O4/c1-16(2)11-19-21(29)25(9-10-31-3)13-18-14-26(22(30)27(18)19)15-20(28)24-8-6-17-5-4-7-23-12-17/h4-5,7,12,16,18-19H,6,8-11,13-15H2,1-3H3,(H,24,28) |
| InChIKey | TVHDLSXCLAOVSW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |