C20H30N4O5S — CID 171148882
1-[2-(3-methoxypropyl)-1,3,3-trioxo-4,5,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]thiadiazepin-8-yl]-3-(2-phenylethyl)urea (PubChem CID 171148882) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-1,3,3-trioxo-4,5,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]thiadiazepin-8-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[2-(3-methoxypropyl)-1,3,3-trioxo-4,5,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]thiadiazepin-8-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 171148882 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-1,3,3-trioxo-4,5,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]thiadiazepin-8-yl]-3-(2-phenylethyl)urea |
| SMILES | COCCCN1C(=O)C2CC(NC(=O)NCCc3ccccc3)CN2CCS1(=O)=O |
| InChI | InChI=1S/C20H30N4O5S/c1-29-12-5-10-24-19(25)18-14-17(15-23(18)11-13-30(24,27)28)22-20(26)21-9-8-16-6-3-2-4-7-16/h2-4,6-7,17-18H,5,8-15H2,1H3,(H2,21,22,26) |
| InChIKey | IPGFSHCQUIYMEZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|