C22H27N3O2 — CID 171148969
[3a-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1-phenylcyclopropyl)methanone (PubChem CID 171148969) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is [3a-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1-phenylcyclopropyl)methanone.
| Compound Name | [3a-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1-phenylcyclopropyl)methanone |
|---|---|
| PubChem CID | 171148969 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | [3a-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1-phenylcyclopropyl)methanone |
| SMILES | CC(C)c1nc(C23CCCC2CN(C(=O)C2(c4ccccc4)CC2)C3)no1 |
| InChI | InChI=1S/C22H27N3O2/c1-15(2)18-23-19(24-27-18)22-10-6-9-17(22)13-25(14-22)20(26)21(11-12-21)16-7-4-3-5-8-16/h3-5,7-8,15,17H,6,9-14H2,1-2H3 |
| InChIKey | GPHFRQRGXGSWPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |