C17H16N6O — CID 171149152
6-imidazol-1-yl-N-[(4-prop-2-enoxyphenyl)methylideneamino]pyridazin-3-amine (PubChem CID 171149152) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 6-imidazol-1-yl-N-[(4-prop-2-enoxyphenyl)methylideneamino]pyridazin-3-amine.
| Compound Name | 6-imidazol-1-yl-N-[(4-prop-2-enoxyphenyl)methylideneamino]pyridazin-3-amine |
|---|---|
| PubChem CID | 171149152 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 6-imidazol-1-yl-N-[(4-prop-2-enoxyphenyl)methylideneamino]pyridazin-3-amine |
| SMILES | C=CCOc1ccc(C=NNc2ccc(-n3ccnc3)nn2)cc1 |
| InChI | InChI=1S/C17H16N6O/c1-2-11-24-15-5-3-14(4-6-15)12-19-20-16-7-8-17(22-21-16)23-10-9-18-13-23/h2-10,12-13H,1,11H2,(H,20,21) |
| InChIKey | ZGNHPCKGZHXAOV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|