C25H31N3O7 — CID 171149698
formic acid;6-[4-(3-phenylprop-2-enyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl]-1H-pyridin-2-one (PubChem CID 171149698) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is formic acid;6-[4-(3-phenylprop-2-enyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl]-1H-pyridin-2-one.
| Compound Name | formic acid;6-[4-(3-phenylprop-2-enyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171149698 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | formic acid;6-[4-(3-phenylprop-2-enyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CCC2(CC1)CN(CC=Cc1ccccc1)CCO2.O=CO.O=CO |
| InChI | InChI=1S/C23H27N3O3.2CH2O2/c27-21-10-4-9-20(24-21)22(28)26-14-11-23(12-15-26)18-25(16-17-29-23)13-5-8-19-6-2-1-3-7-19;2*2-1-3/h1-10H,11-18H2,(H,24,27);2*1H,(H,2,3) |
| InChIKey | SCBIVHTZLZHQBX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|