C22H27N3O3 — CID 91939946
1-[3-oxo-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]cyclopropane-1-carboxamide (PubChem CID 91939946) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[3-oxo-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[3-oxo-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91939946 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[3-oxo-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(C(=O)N2CCC3(CC2)CC(=O)N(CC=Cc2ccccc2)C3)CC1 |
| InChI | InChI=1S/C22H27N3O3/c23-19(27)22(8-9-22)20(28)24-13-10-21(11-14-24)15-18(26)25(16-21)12-4-7-17-5-2-1-3-6-17/h1-7H,8-16H2,(H2,23,27) |
| InChIKey | PFSCBBYKWOXLDS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|