C21H30N2O3 — CID 91940760
8-[2-(2-hydroxyethoxy)ethyl]-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 91940760) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 8-[2-(2-hydroxyethoxy)ethyl]-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-[2-(2-hydroxyethoxy)ethyl]-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 91940760 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 8-[2-(2-hydroxyethoxy)ethyl]-2-(3-phenylprop-2-enyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(CCOCCO)CC2)CN1CC=Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2O3/c24-14-16-26-15-13-22-11-8-21(9-12-22)17-20(25)23(18-21)10-4-7-19-5-2-1-3-6-19/h1-7,24H,8-18H2 |
| InChIKey | PBVHCPZFBKTNGL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|