C30H42N4O5 — CID 171151350
(4-benzylpiperazin-1-yl)-[1-[[4-(diethylamino)phenyl]methyl]piperidin-4-yl]methanone;oxalic acid (PubChem CID 171151350) has the molecular formula C30H42N4O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-[[4-(diethylamino)phenyl]methyl]piperidin-4-yl]methanone;oxalic acid.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-[[4-(diethylamino)phenyl]methyl]piperidin-4-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 171151350 |
| Molecular Formula | C30H42N4O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-[[4-(diethylamino)phenyl]methyl]piperidin-4-yl]methanone;oxalic acid |
| SMILES | CCN(CC)c1ccc(CN2CCC(C(=O)N3CCN(Cc4ccccc4)CC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C28H40N4O.C2H2O4/c1-3-31(4-2)27-12-10-25(11-13-27)23-29-16-14-26(15-17-29)28(33)32-20-18-30(19-21-32)22-24-8-6-5-7-9-24;3-1(4)2(5)6/h5-13,26H,3-4,14-23H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | KQRHQZCNQANPRQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|