C20H26ClN3O4 — CID 171151539
3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-hydroxyphenyl)methylideneamino]propanamide;hydrochloride (PubChem CID 171151539) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-hydroxyphenyl)methylideneamino]propanamide;hydrochloride.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-hydroxyphenyl)methylideneamino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 171151539 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(2-hydroxyphenyl)methylideneamino]propanamide;hydrochloride |
| SMILES | COc1ccc(CCNCCC(=O)NN=Cc2ccccc2O)cc1OC.Cl |
| InChI | InChI=1S/C20H25N3O4.ClH/c1-26-18-8-7-15(13-19(18)27-2)9-11-21-12-10-20(25)23-22-14-16-5-3-4-6-17(16)24;/h3-8,13-14,21,24H,9-12H2,1-2H3,(H,23,25);1H |
| InChIKey | KZJCAHVPAPTPDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|