C24H27N3O4 — CID 135913097
3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide (PubChem CID 135913097) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135913097 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylamino]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanamide |
| SMILES | COc1ccc(CCNCCC(=O)N/N=C\c2c(O)ccc3ccccc23)cc1OC |
| InChI | InChI=1S/C24H27N3O4/c1-30-22-10-7-17(15-23(22)31-2)11-13-25-14-12-24(29)27-26-16-20-19-6-4-3-5-18(19)8-9-21(20)28/h3-10,15-16,25,28H,11-14H2,1-2H3,(H,27,29)/b26-16- |
| InChIKey | CLENQZUSVHBBFE-QQXSKIMKSA-N |
| XLogP | 3.24 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|