C15H20ClN3O2S — CID 171151566
ethyl 3-amino-3-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)imino]propanoate;hydrochloride (PubChem CID 171151566) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is ethyl 3-amino-3-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)imino]propanoate;hydrochloride.
| Compound Name | ethyl 3-amino-3-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)imino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171151566 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | ethyl 3-amino-3-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)imino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(N)=Nc1sc2c(c1C#N)CCCCC2.Cl |
| InChI | InChI=1S/C15H19N3O2S.ClH/c1-2-20-14(19)8-13(17)18-15-11(9-16)10-6-4-3-5-7-12(10)21-15;/h2-8H2,1H3,(H2,17,18);1H |
| InChIKey | WEMJPNHXWILGIS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|