C20H21BrN2O5 — CID 171154302
N-(4-bromophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide;oxalic acid (PubChem CID 171154302) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide;oxalic acid.
| Compound Name | N-(4-bromophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154302 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-(4-bromophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide;oxalic acid |
| SMILES | O=C(CCN1CCc2ccccc2C1)Nc1ccc(Br)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H19BrN2O.C2H2O4/c19-16-5-7-17(8-6-16)20-18(22)10-12-21-11-9-14-3-1-2-4-15(14)13-21;3-1(4)2(5)6/h1-8H,9-13H2,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | SCHGOPMXGOBREE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|