C20H28N2O7 — CID 171154477
ethyl 1-[3-(2-methylanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid (PubChem CID 171154477) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl 1-[3-(2-methylanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid.
| Compound Name | ethyl 1-[3-(2-methylanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 171154477 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | ethyl 1-[3-(2-methylanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)C1CCCN(CCC(=O)Nc2ccccc2C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26N2O3.C2H2O4/c1-3-23-18(22)15-8-6-11-20(13-15)12-10-17(21)19-16-9-5-4-7-14(16)2;3-1(4)2(5)6/h4-5,7,9,15H,3,6,8,10-13H2,1-2H3,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | RHPBMKMSNKDCLP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|