C21H30N2O9 — CID 171154487
ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid (PubChem CID 171154487) has the molecular formula C21H30N2O9 and a molecular weight of 454.48 g/mol. Its IUPAC name is ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid.
| Compound Name | ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 171154487 |
| Molecular Formula | C21H30N2O9 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | ethyl 1-[3-(3,5-dimethoxyanilino)-3-oxopropyl]piperidine-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)C1CCCN(CCC(=O)Nc2cc(OC)cc(OC)c2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H28N2O5.C2H2O4/c1-4-26-19(23)14-6-5-8-21(13-14)9-7-18(22)20-15-10-16(24-2)12-17(11-15)25-3;3-1(4)2(5)6/h10-12,14H,4-9,13H2,1-3H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | MBLGJPXLGOGOPX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|