C18H25ClN2O5 — CID 171154563
N-(2-chlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;oxalic acid (PubChem CID 171154563) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;oxalic acid.
| Compound Name | N-(2-chlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154563 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(2-chlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)propanamide;oxalic acid |
| SMILES | CC1CC(C)CN(CCC(=O)Nc2ccccc2Cl)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H23ClN2O.C2H2O4/c1-12-9-13(2)11-19(10-12)8-7-16(20)18-15-6-4-3-5-14(15)17;3-1(4)2(5)6/h3-6,12-13H,7-11H2,1-2H3,(H,18,20);(H,3,4)(H,5,6) |
| InChIKey | GFDZXXJJHNBLGO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|