C20H24N4O2 — CID 171156687
1-[2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl]-3-phenylprop-2-en-1-one (PubChem CID 171156687) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 171156687 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)N1CCc2nc(C3CCOCC3)nn2CC1 |
| InChI | InChI=1S/C20H24N4O2/c25-19(7-6-16-4-2-1-3-5-16)23-11-8-18-21-20(22-24(18)13-12-23)17-9-14-26-15-10-17/h1-7,17H,8-15H2 |
| InChIKey | VZMAIWHWQOKANZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|