C33H35ClN2O7 — CID 171156855
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride (PubChem CID 171156855) has the molecular formula C33H35ClN2O7 and a molecular weight of 607.10 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 171156855 |
| Molecular Formula | C33H35ClN2O7 |
| Molecular Weight | 607.10 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ylpropyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione;hydrochloride |
| SMILES | Cl.O=C1C(=O)N(CCCN2CCOCC2)C(c2cccc(OCc3ccccc3)c2)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C33H34N2O7.ClH/c36-31(25-10-11-27-28(21-25)41-19-18-40-27)29-30(24-8-4-9-26(20-24)42-22-23-6-2-1-3-7-23)35(33(38)32(29)37)13-5-12-34-14-16-39-17-15-34;/h1-4,6-11,20-21,30,36H,5,12-19,22H2;1H |
| InChIKey | CMJJQXJJOBNHJS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.10 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|