C29H27NO7 — CID 41064881
(5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 41064881) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41064881 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(2-methoxyethyl)-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc3c(c2)OCCO3)[C@H]1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H27NO7/c1-34-13-12-30-26(20-8-5-9-22(16-20)37-18-19-6-3-2-4-7-19)25(28(32)29(30)33)27(31)21-10-11-23-24(17-21)36-15-14-35-23/h2-11,16-17,26,31H,12-15,18H2,1H3/t26-/m1/s1 |
| InChIKey | ANVXDRPYAIXOMA-AREMUKBSSA-N |
| XLogP | 4.10 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|