C18H24N4O2 — CID 171159109
N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-3-methylbenzamide (PubChem CID 171159109) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-3-methylbenzamide.
| Compound Name | N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 171159109 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[(1R,2R,5S)-5-(2,5-dimethyl-1,2,4-triazol-3-yl)-2-hydroxycyclohexyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H]2C[C@@H](c3nc(C)nn3C)CC[C@H]2O)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-11-5-4-6-14(9-11)18(24)20-15-10-13(7-8-16(15)23)17-19-12(2)21-22(17)3/h4-6,9,13,15-16,23H,7-8,10H2,1-3H3,(H,20,24)/t13-,15+,16+/m0/s1 |
| InChIKey | VXHVAJKIUMENQG-NUEKZKHPSA-N |
| XLogP | 1.86 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |