C16H25ClF2N2 — CID 171163026
1-[(1S)-1-(2,4-difluorophenyl)hexyl]piperazine;hydrochloride (PubChem CID 171163026) has the molecular formula C16H25ClF2N2 and a molecular weight of 318.84 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-difluorophenyl)hexyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(2,4-difluorophenyl)hexyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171163026 |
| Molecular Formula | C16H25ClF2N2 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[(1S)-1-(2,4-difluorophenyl)hexyl]piperazine;hydrochloride |
| SMILES | CCCCC[C@@H](c1ccc(F)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C16H24F2N2.ClH/c1-2-3-4-5-16(20-10-8-19-9-11-20)14-7-6-13(17)12-15(14)18;/h6-7,12,16,19H,2-5,8-11H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | NBTALDUXVYLHLD-NTISSMGPSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|