C16H27Cl2FN2 — CID 171307766
1-[(1R)-1-(5-fluoro-2-methylphenyl)pentyl]piperazine;dihydrochloride (PubChem CID 171307766) has the molecular formula C16H27Cl2FN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 1-[(1R)-1-(5-fluoro-2-methylphenyl)pentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(5-fluoro-2-methylphenyl)pentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171307766 |
| Molecular Formula | C16H27Cl2FN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[(1R)-1-(5-fluoro-2-methylphenyl)pentyl]piperazine;dihydrochloride |
| SMILES | CCCC[C@H](c1cc(F)ccc1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H25FN2.2ClH/c1-3-4-5-16(19-10-8-18-9-11-19)15-12-14(17)7-6-13(15)2;;/h6-7,12,16,18H,3-5,8-11H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | IWDLPDVCHYXFSV-GGMCWBHBSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |