C15H23FN2O2 — CID 171168476
1-[(1R)-1-(2,3-dimethoxyphenyl)-3-fluoropropyl]piperazine (PubChem CID 171168476) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-dimethoxyphenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,3-dimethoxyphenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171168476 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[(1R)-1-(2,3-dimethoxyphenyl)-3-fluoropropyl]piperazine |
| SMILES | COc1cccc([C@@H](CCF)N2CCNCC2)c1OC |
| InChI | InChI=1S/C15H23FN2O2/c1-19-14-5-3-4-12(15(14)20-2)13(6-7-16)18-10-8-17-9-11-18/h3-5,13,17H,6-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | IQUMUUPMHKRYHC-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |