C17H29Cl2FN2O — CID 171310774
1-[(1R)-1-(3-fluoro-2-methoxyphenyl)-4-methylpentyl]piperazine;dihydrochloride (PubChem CID 171310774) has the molecular formula C17H29Cl2FN2O and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-[(1R)-1-(3-fluoro-2-methoxyphenyl)-4-methylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-fluoro-2-methoxyphenyl)-4-methylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171310774 |
| Molecular Formula | C17H29Cl2FN2O |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(1R)-1-(3-fluoro-2-methoxyphenyl)-4-methylpentyl]piperazine;dihydrochloride |
| SMILES | COc1c(F)cccc1[C@@H](CCC(C)C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H27FN2O.2ClH/c1-13(2)7-8-16(20-11-9-19-10-12-20)14-5-4-6-15(18)17(14)21-3;;/h4-6,13,16,19H,7-12H2,1-3H3;2*1H/t16-;;/m1../s1 |
| InChIKey | XJUZQSJOIPPWET-GGMCWBHBSA-N |
| XLogP | 4.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |