C21H32Cl2N2O — CID 171311328
1-[(1R)-1-(4-methoxynaphthalen-1-yl)-4-methylpentyl]piperazine;dihydrochloride (PubChem CID 171311328) has the molecular formula C21H32Cl2N2O and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methoxynaphthalen-1-yl)-4-methylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4-methoxynaphthalen-1-yl)-4-methylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171311328 |
| Molecular Formula | C21H32Cl2N2O |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[(1R)-1-(4-methoxynaphthalen-1-yl)-4-methylpentyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@@H](CCC(C)C)N2CCNCC2)c2ccccc12.Cl.Cl |
| InChI | InChI=1S/C21H30N2O.2ClH/c1-16(2)8-10-20(23-14-12-22-13-15-23)18-9-11-21(24-3)19-7-5-4-6-17(18)19;;/h4-7,9,11,16,20,22H,8,10,12-15H2,1-3H3;2*1H/t20-;;/m1../s1 |
| InChIKey | XCEMQKQOKBYQBN-FAVHNTAZSA-N |
| XLogP | 5.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |