C18H30N2O3 — CID 171273831
1-[(1S)-3-methyl-1-(2,3,4-trimethoxyphenyl)butyl]piperazine (PubChem CID 171273831) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-(2,3,4-trimethoxyphenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-3-methyl-1-(2,3,4-trimethoxyphenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171273831 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[(1S)-3-methyl-1-(2,3,4-trimethoxyphenyl)butyl]piperazine |
| SMILES | COc1ccc([C@H](CC(C)C)N2CCNCC2)c(OC)c1OC |
| InChI | InChI=1S/C18H30N2O3/c1-13(2)12-15(20-10-8-19-9-11-20)14-6-7-16(21-3)18(23-5)17(14)22-4/h6-7,13,15,19H,8-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | ZLGGIFLXGDFJTO-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |