C17H30Cl2N2O2 — CID 171287474
1-[(1R)-1-(2,6-dimethoxyphenyl)-3-methylbutyl]piperazine;dihydrochloride (PubChem CID 171287474) has the molecular formula C17H30Cl2N2O2 and a molecular weight of 365.35 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-dimethoxyphenyl)-3-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,6-dimethoxyphenyl)-3-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171287474 |
| Molecular Formula | C17H30Cl2N2O2 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[(1R)-1-(2,6-dimethoxyphenyl)-3-methylbutyl]piperazine;dihydrochloride |
| SMILES | COc1cccc(OC)c1[C@@H](CC(C)C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H28N2O2.2ClH/c1-13(2)12-14(19-10-8-18-9-11-19)17-15(20-3)6-5-7-16(17)21-4;;/h5-7,13-14,18H,8-12H2,1-4H3;2*1H/t14-;;/m1../s1 |
| InChIKey | LLAORPFYJAPTGP-FMOMHUKBSA-N |
| XLogP | 3.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |