C30H30N2O4 — CID 17117640
N-[4-[[2-(4-cyclohexylphenoxy)acetyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 17117640) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[4-[[2-(4-cyclohexylphenoxy)acetyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[[2-(4-cyclohexylphenoxy)acetyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17117640 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[4-[[2-(4-cyclohexylphenoxy)acetyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(C3CCCCC3)cc2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C30H30N2O4/c1-20-17-24(13-16-26(20)32-30(34)28-18-23-9-5-6-10-27(23)36-28)31-29(33)19-35-25-14-11-22(12-15-25)21-7-3-2-4-8-21/h5-6,9-18,21H,2-4,7-8,19H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | SHMINUFEOUAULC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |