C22H26INO2 — CID 23095771
2-(4-cyclohexylphenoxy)-N-(4-iodo-2,5-dimethylphenyl)acetamide (PubChem CID 23095771) has the molecular formula C22H26INO2 and a molecular weight of 463.36 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-N-(4-iodo-2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(4-cyclohexylphenoxy)-N-(4-iodo-2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23095771 |
| Molecular Formula | C22H26INO2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-N-(4-iodo-2,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(C3CCCCC3)cc2)c(C)cc1I |
| InChI | InChI=1S/C22H26INO2/c1-15-13-21(16(2)12-20(15)23)24-22(25)14-26-19-10-8-18(9-11-19)17-6-4-3-5-7-17/h8-13,17H,3-7,14H2,1-2H3,(H,24,25) |
| InChIKey | GMNSWPQZPJNPEV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|