C20H21BrINO2 — CID 3925742
N-(4-bromo-2-iodophenyl)-2-(4-cyclohexylphenoxy)acetamide (PubChem CID 3925742) has the molecular formula C20H21BrINO2 and a molecular weight of 514.20 g/mol. Its IUPAC name is N-(4-bromo-2-iodophenyl)-2-(4-cyclohexylphenoxy)acetamide.
| Compound Name | N-(4-bromo-2-iodophenyl)-2-(4-cyclohexylphenoxy)acetamide |
|---|---|
| PubChem CID | 3925742 |
| Molecular Formula | C20H21BrINO2 |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | N-(4-bromo-2-iodophenyl)-2-(4-cyclohexylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(C2CCCCC2)cc1)Nc1ccc(Br)cc1I |
| InChI | InChI=1S/C20H21BrINO2/c21-16-8-11-19(18(22)12-16)23-20(24)13-25-17-9-6-15(7-10-17)14-4-2-1-3-5-14/h6-12,14H,1-5,13H2,(H,23,24) |
| InChIKey | XNBWSLMHXKPOFC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.20 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|