C18H19BrINO2 — CID 3872466
N-(4-bromo-2-iodophenyl)-2-(4-tert-butylphenoxy)acetamide (PubChem CID 3872466) has the molecular formula C18H19BrINO2 and a molecular weight of 488.16 g/mol. Its IUPAC name is N-(4-bromo-2-iodophenyl)-2-(4-tert-butylphenoxy)acetamide.
| Compound Name | N-(4-bromo-2-iodophenyl)-2-(4-tert-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 3872466 |
| Molecular Formula | C18H19BrINO2 |
| Molecular Weight | 488.16 g/mol |
| Exact Mass | 486.96 |
| IUPAC Name | N-(4-bromo-2-iodophenyl)-2-(4-tert-butylphenoxy)acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2ccc(Br)cc2I)cc1 |
| InChI | InChI=1S/C18H19BrINO2/c1-18(2,3)12-4-7-14(8-5-12)23-11-17(22)21-16-9-6-13(19)10-15(16)20/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | RRDBKEYTRFQXPU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.16 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|