C23H25Cl3N2O2S — CID 17117833
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide (PubChem CID 17117833) has the molecular formula C23H25Cl3N2O2S and a molecular weight of 499.89 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17117833 |
| Molecular Formula | C23H25Cl3N2O2S |
| Molecular Weight | 499.89 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1c(Cl)c(C)c(Cl)c(OCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)c1Cl |
| InChI | InChI=1S/C23H25Cl3N2O2S/c1-11-18(24)12(2)20(26)21(19(11)25)30-10-17(29)28-22-15(9-27)14-7-6-13(23(3,4)5)8-16(14)31-22/h13H,6-8,10H2,1-5H3,(H,28,29) |
| InChIKey | GFRXFNMLLZQUTG-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.89 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |