C12H17Cl2N3O3 — CID 171183496
(2R)-2-(4-chloro-3-nitrophenyl)-2-piperazin-1-ylethanol;hydrochloride (PubChem CID 171183496) has the molecular formula C12H17Cl2N3O3 and a molecular weight of 322.19 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-nitrophenyl)-2-piperazin-1-ylethanol;hydrochloride.
| Compound Name | (2R)-2-(4-chloro-3-nitrophenyl)-2-piperazin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 171183496 |
| Molecular Formula | C12H17Cl2N3O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2R)-2-(4-chloro-3-nitrophenyl)-2-piperazin-1-ylethanol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc([C@H](CO)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C12H16ClN3O3.ClH/c13-10-2-1-9(7-11(10)16(18)19)12(8-17)15-5-3-14-4-6-15;/h1-2,7,12,14,17H,3-6,8H2;1H/t12-;/m0./s1 |
| InChIKey | GNFAJMZUQONOKH-YDALLXLXSA-N |
| XLogP | 1.61 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|