C15H24Cl3N3O2 — CID 171305349
1-[(1S)-1-(4-chloro-3-nitrophenyl)-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171305349) has the molecular formula C15H24Cl3N3O2 and a molecular weight of 384.74 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chloro-3-nitrophenyl)-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(4-chloro-3-nitrophenyl)-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305349 |
| Molecular Formula | C15H24Cl3N3O2 |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-[(1S)-1-(4-chloro-3-nitrophenyl)-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1ccc(Cl)c([N+](=O)[O-])c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H22ClN3O2.2ClH/c1-3-11(2)15(18-8-6-17-7-9-18)12-4-5-13(16)14(10-12)19(20)21;;/h4-5,10-11,15,17H,3,6-9H2,1-2H3;2*1H/t11?,15-;;/m0../s1 |
| InChIKey | VNASGAVJONBJSX-QEDFBYNOSA-N |
| XLogP | 4.08 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|