C22H22FN3O3 — CID 17118476
2-(3-cyclopentyl-2,5-dioxo-1-phenylimidazolidin-4-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 17118476) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,5-dioxo-1-phenylimidazolidin-4-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(3-cyclopentyl-2,5-dioxo-1-phenylimidazolidin-4-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 17118476 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-(3-cyclopentyl-2,5-dioxo-1-phenylimidazolidin-4-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1C(=O)N(c2ccccc2)C(=O)N1C1CCCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O3/c23-15-10-12-16(13-11-15)24-20(27)14-19-21(28)26(18-6-2-1-3-7-18)22(29)25(19)17-8-4-5-9-17/h1-3,6-7,10-13,17,19H,4-5,8-9,14H2,(H,24,27) |
| InChIKey | PNKRPCYFJVVBIL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|