C23H25N3O3 — CID 6622829
2-[3-cyclopropyl-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 6622829) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[3-cyclopropyl-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[3-cyclopropyl-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 6622829 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[3-cyclopropyl-1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CC2C(=O)N(c3cccc(C)c3)C(=O)N2C2CC2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-16-7-9-17(10-8-16)24-21(27)14-20-22(28)26(19-6-4-5-15(2)13-19)23(29)25(20)18-11-12-18/h4-10,13,18,20H,3,11-12,14H2,1-2H3,(H,24,27) |
| InChIKey | MTIHXVBBZYRQQL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|