C12H15NO5 — CID 171185100
(4R)-4-(2-hydroxy-4,6-dimethoxyphenyl)-1,3-oxazinan-2-one (PubChem CID 171185100) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (4R)-4-(2-hydroxy-4,6-dimethoxyphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(2-hydroxy-4,6-dimethoxyphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171185100 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (4R)-4-(2-hydroxy-4,6-dimethoxyphenyl)-1,3-oxazinan-2-one |
| SMILES | COc1cc(O)c([C@H]2CCOC(=O)N2)c(OC)c1 |
| InChI | InChI=1S/C12H15NO5/c1-16-7-5-9(14)11(10(6-7)17-2)8-3-4-18-12(15)13-8/h5-6,8,14H,3-4H2,1-2H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | VIPSMCCPEOKEOL-MRVPVSSYSA-N |
| XLogP | 1.58 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|