C12H12F3NO4 — CID 171185420
(4R)-4-[2-methoxy-4-(trifluoromethoxy)phenyl]-1,3-oxazinan-2-one (PubChem CID 171185420) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is (4R)-4-[2-methoxy-4-(trifluoromethoxy)phenyl]-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-[2-methoxy-4-(trifluoromethoxy)phenyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171185420 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (4R)-4-[2-methoxy-4-(trifluoromethoxy)phenyl]-1,3-oxazinan-2-one |
| SMILES | COc1cc(OC(F)(F)F)ccc1[C@H]1CCOC(=O)N1 |
| InChI | InChI=1S/C12H12F3NO4/c1-18-10-6-7(20-12(13,14)15)2-3-8(10)9-4-5-19-11(17)16-9/h2-3,6,9H,4-5H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | LPRWZAOOJWCEEC-SECBINFHSA-N |
| XLogP | 2.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |