C14H19NO4 — CID 171187783
(4S)-4-(2,4-dimethoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one (PubChem CID 171187783) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4S)-4-(2,4-dimethoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(2,4-dimethoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171187783 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4S)-4-(2,4-dimethoxyphenyl)-5,5-dimethyl-1,3-oxazinan-2-one |
| SMILES | COc1ccc([C@H]2NC(=O)OCC2(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-14(2)8-19-13(16)15-12(14)10-6-5-9(17-3)7-11(10)18-4/h5-7,12H,8H2,1-4H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | LKNPWNCJVIGTLG-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |