About (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride
(4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171187840) has the molecular formula C11H11ClF3NO3
and a molecular weight of 297.66 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 171187840 |
| Molecular Formula | C11H11ClF3NO3 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | COc1ccc([C@H]2NC(=O)OCC2(F)F)cc1F.Cl |
| InChI | InChI=1S/C11H10F3NO3.ClH/c1-17-8-3-2-6(4-7(8)12)9-11(13,14)5-18-10(16)15-9;/h2-4,9H,5H2,1H3,(H,15,16);1H/t9-;/m1./s1 |
| InChIKey | ZMSJUYZGHVQHCI-SBSPUUFOSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride (CID 171187840) is (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride is COc1ccc([C@H]2NC(=O)OCC2(F)F)cc1F.Cl.
What is the InChIKey of (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is ZMSJUYZGHVQHCI-SBSPUUFOSA-N. The full InChI is InChI=1S/C11H10F3NO3.ClH/c1-17-8-3-2-6(4-7(8)12)9-11(13,14)5-18-10(16)15-9;/h2-4,9H,5H2,1H3,(H,15,16);1H/t9-;/m1./s1.
What are the key properties of (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride?
(4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 297.66 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5-difluoro-4-(3-fluoro-4-methoxyphenyl)-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 171187840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).