C12H13F2NO3 — CID 171188929
(4R)-5,5-difluoro-4-(4-methoxy-3-methylphenyl)-1,3-oxazinan-2-one (PubChem CID 171188929) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-(4-methoxy-3-methylphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-5,5-difluoro-4-(4-methoxy-3-methylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 171188929 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (4R)-5,5-difluoro-4-(4-methoxy-3-methylphenyl)-1,3-oxazinan-2-one |
| SMILES | COc1ccc([C@H]2NC(=O)OCC2(F)F)cc1C |
| InChI | InChI=1S/C12H13F2NO3/c1-7-5-8(3-4-9(7)17-2)10-12(13,14)6-18-11(16)15-10/h3-5,10H,6H2,1-2H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YCIJNVBKNNZBOH-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |