C25H35N3O3 — CID 17118805
N-cyclooctyl-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 17118805) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-cyclooctyl-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-cyclooctyl-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17118805 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-cyclooctyl-1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCN(C(=O)C2CC(=O)N(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C25H35N3O3/c29-23-17-20(18-28(23)22-11-7-4-8-12-22)25(31)27-15-13-19(14-16-27)24(30)26-21-9-5-2-1-3-6-10-21/h4,7-8,11-12,19-21H,1-3,5-6,9-10,13-18H2,(H,26,30) |
| InChIKey | JHJGJXBSXCJYQF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |