C23H25N3O3 — CID 46576515
N-[1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidin-4-yl]benzamide (PubChem CID 46576515) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | N-[1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46576515 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[1-(5-oxo-1-phenylpyrrolidine-3-carbonyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)C2CC(=O)N(c3ccccc3)C2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c27-21-15-18(16-26(21)20-9-5-2-6-10-20)23(29)25-13-11-19(12-14-25)24-22(28)17-7-3-1-4-8-17/h1-10,18-19H,11-16H2,(H,24,28) |
| InChIKey | DURGRIJSHXGMSM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |