C8H11ClF7N — CID 171195598
(2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)piperidine;hydrochloride (PubChem CID 171195598) has the molecular formula C8H11ClF7N and a molecular weight of 289.62 g/mol. Its IUPAC name is (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)piperidine;hydrochloride.
| Compound Name | (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195598 |
| Molecular Formula | C8H11ClF7N |
| Molecular Weight | 289.62 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)C(F)(F)C(F)(F)[C@H]1CCCCN1 |
| InChI | InChI=1S/C8H10F7N.ClH/c9-6(10,5-3-1-2-4-16-5)7(11,12)8(13,14)15;/h5,16H,1-4H2;1H/t5-;/m1./s1 |
| InChIKey | FQPHHKQIBFHHSC-NUBCRITNSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|