C9H10Cl3NO — CID 171205225
4-[(1R)-1-aminoprop-2-enyl]-2,6-dichlorophenol;hydrochloride (PubChem CID 171205225) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is 4-[(1R)-1-aminoprop-2-enyl]-2,6-dichlorophenol;hydrochloride.
| Compound Name | 4-[(1R)-1-aminoprop-2-enyl]-2,6-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171205225 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 4-[(1R)-1-aminoprop-2-enyl]-2,6-dichlorophenol;hydrochloride |
| SMILES | C=C[C@@H](N)c1cc(Cl)c(O)c(Cl)c1.Cl |
| InChI | InChI=1S/C9H9Cl2NO.ClH/c1-2-8(12)5-3-6(10)9(13)7(11)4-5;/h2-4,8,13H,1,12H2;1H/t8-;/m1./s1 |
| InChIKey | CASLZNYXYGIQAC-DDWIOCJRSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|