About (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride
(1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride (PubChem CID 171212323) has the molecular formula C8H15ClN2O
and a molecular weight of 190.67 g/mol. Its IUPAC name is (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride |
| PubChem CID | 171212323 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1ccoc1 |
| InChI | InChI=1S/C8H14N2O.ClH/c9-4-1-2-8(10)7-3-5-11-6-7;/h3,5-6,8H,1-2,4,9-10H2;1H/t8-;/m1./s1 |
| InChIKey | HXTAZHKKFKSGRK-DDWIOCJRSA-N |
| XLogP | 1.44 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride?
The IUPAC name of (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride (CID 171212323) is (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride.
What is the SMILES notation for (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride?
The canonical SMILES for (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride is Cl.NCCC[C@@H](N)c1ccoc1.
What is the InChIKey of (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride?
The InChIKey is HXTAZHKKFKSGRK-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H14N2O.ClH/c9-4-1-2-8(10)7-3-5-11-6-7;/h3,5-6,8H,1-2,4,9-10H2;1H/t8-;/m1./s1.
What are the key properties of (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride?
(1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride has a molecular weight of 190.67 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride is sourced from PubChem (CID 171212323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).