C8H15ClN2O — CID 171212323
(1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride (PubChem CID 171212323) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171212323 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (1R)-1-(furan-3-yl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1ccoc1 |
| InChI | InChI=1S/C8H14N2O.ClH/c9-4-1-2-8(10)7-3-5-11-6-7;/h3,5-6,8H,1-2,4,9-10H2;1H/t8-;/m1./s1 |
| InChIKey | HXTAZHKKFKSGRK-DDWIOCJRSA-N |
| XLogP | 1.44 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |