C19H25N3 — CID 171213041
(1R)-1-(9-ethylcarbazol-3-yl)pentane-1,5-diamine (PubChem CID 171213041) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is (1R)-1-(9-ethylcarbazol-3-yl)pentane-1,5-diamine.
| Compound Name | (1R)-1-(9-ethylcarbazol-3-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171213041 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | (1R)-1-(9-ethylcarbazol-3-yl)pentane-1,5-diamine |
| SMILES | CCn1c2ccccc2c2cc([C@H](N)CCCCN)ccc21 |
| InChI | InChI=1S/C19H25N3/c1-2-22-18-9-4-3-7-15(18)16-13-14(10-11-19(16)22)17(21)8-5-6-12-20/h3-4,7,9-11,13,17H,2,5-6,8,12,20-21H2,1H3/t17-/m1/s1 |
| InChIKey | WKIDXVSJDNJHNU-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|